ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
| اسم المنتج |
methyl 2-[(cyanomethyl)thio]benzoate |
| الاسم المستعار |
methyl 2-[(cyanomethyl)sulfanyl]benzoate |
| الصيغة الجزيئية |
C10H9NO2S |
| الوزن الجزيئي الغرامي |
207.249 |
| InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
| إستراتيجية المساعدة القطرية |
57601-89-5 |
| بنية جزيئية |
![57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate](https://images-a.chemnet.com/suppliers/chembase/143/14321.gif)
|
| كثافة |
1.24g/cm3 |
| درجة الإنصهار |
121℃ |
| نقطة الغليان |
338.6°C at 760 mmHg |
| معامل الإنكسار |
1.574 |
| نقطة الوميض |
158.6°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
